Products 1173022-97-3
CAS 1173022-97-3 is the registry number for p-Anisic acid-13C6. Offered by: MedChemExpress. Available pack sizes: 1mg, 5mg.
4-methoxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylic acid (CAS 1173022-97-3) is a chemical compound with the molecular formula C8H8O3 and a molecular weight of 158.10 g/mol. IUPAC name: 4-methoxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylic acid. InChIKey: ZEYHEAKUIGZSGI-WBJZHHNVSA-N.
| Molecular formula | C8H8O3 |
|---|---|
| Molecular weight | 158.10 g/mol |
| IUPAC name | 4-methoxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylic acid |
| InChIKey | ZEYHEAKUIGZSGI-WBJZHHNVSA-N |
| SMILES | CO[13C]1=[13CH][13CH]=[13C]([13CH]=[13CH]1)C(=O)O |
Computed by PubChem (NCBI)