Products 1219803-08-3
CAS 1219803-08-3 appears in our catalog under these names: 4-Methoxybenzoic-d7 Acid, 98 atom % D, min 98% Chemical Purity, p-Anisic acid-d7. Offered by: CDN, MedChemExpress. Available pack sizes: 0,5g, 0,25g, Get quote.
2,3,5,6-tetradeuterio-4-(trideuteriomethoxy)benzoic acid (CAS 1219803-08-3) is a chemical compound with the molecular formula C8H8O3 and a molecular weight of 159.19 g/mol. IUPAC name: 2,3,5,6-tetradeuterio-4-(trideuteriomethoxy)benzoic acid. InChIKey: ZEYHEAKUIGZSGI-AAYPNNLASA-N.
| Molecular formula | C8H8O3 |
|---|---|
| Molecular weight | 159.19 g/mol |
| IUPAC name | 2,3,5,6-tetradeuterio-4-(trideuteriomethoxy)benzoic acid |
| InChIKey | ZEYHEAKUIGZSGI-AAYPNNLASA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C(=O)O)[2H])[2H])OC([2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)