CAS 1173054-28-8 is the registry number for 4-(Piperazin-1-ylmethyl)benzamide dihydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.
4-(piperazin-1-ylmethyl)benzamide;dihydrochloride (CAS 1173054-28-8) is a chemical compound with the molecular formula C12H19Cl2N3O and a molecular weight of 292.20 g/mol. IUPAC name: 4-(piperazin-1-ylmethyl)benzamide;dihydrochloride. InChIKey: JCVUMIZCPRVNEI-UHFFFAOYSA-N.
| Molecular formula | C12H19Cl2N3O |
|---|---|
| Molecular weight | 292.20 g/mol |
| IUPAC name | 4-(piperazin-1-ylmethyl)benzamide;dihydrochloride |
| InChIKey | JCVUMIZCPRVNEI-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)CC2=CC=C(C=C2)C(=O)N.Cl.Cl |
Computed by PubChem (NCBI)