CAS 1185298-28-5 is the registry number for 3-Piperazin-1-ylmethyl-benzamide dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
3-(piperazin-1-ylmethyl)benzamide;dihydrochloride (CAS 1185298-28-5) is a chemical compound with the molecular formula C12H19Cl2N3O and a molecular weight of 292.20 g/mol. IUPAC name: 3-(piperazin-1-ylmethyl)benzamide;dihydrochloride. InChIKey: YWNGGWCCHYBIRU-UHFFFAOYSA-N.
| Molecular formula | C12H19Cl2N3O |
|---|---|
| Molecular weight | 292.20 g/mol |
| IUPAC name | 3-(piperazin-1-ylmethyl)benzamide;dihydrochloride |
| InChIKey | YWNGGWCCHYBIRU-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)CC2=CC(=CC=C2)C(=O)N.Cl.Cl |
Computed by PubChem (NCBI)