CAS 1316219-08-5 is the registry number for N,N-Dimethyl-6-pyrrolidin-2-ylpyridine-2-carboxamide dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
N,N-dimethyl-6-pyrrolidin-2-ylpyridine-2-carboxamide;dihydrochloride (CAS 1316219-08-5) is a chemical compound with the molecular formula C12H19Cl2N3O and a molecular weight of 292.20 g/mol. IUPAC name: N,N-dimethyl-6-pyrrolidin-2-ylpyridine-2-carboxamide;dihydrochloride. InChIKey: PNVFHVONEZRSGW-UHFFFAOYSA-N.
| Molecular formula | C12H19Cl2N3O |
|---|---|
| Molecular weight | 292.20 g/mol |
| IUPAC name | N,N-dimethyl-6-pyrrolidin-2-ylpyridine-2-carboxamide;dihydrochloride |
| InChIKey | PNVFHVONEZRSGW-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CC=CC(=N1)C2CCCN2.Cl.Cl |
Computed by PubChem (NCBI)