CAS 1173417-57-6 is the registry number for (E)-(4-Nitrophenyl)(2-thienyl)methanone oxime, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
(NE)-N-[(4-nitrophenyl)-thiophen-2-ylmethylidene]hydroxylamine (CAS 1173417-57-6) is a chemical compound with the molecular formula C11H8N2O3S and a molecular weight of 248.26 g/mol. IUPAC name: (NE)-N-[(4-nitrophenyl)-thiophen-2-ylmethylidene]hydroxylamine. InChIKey: QLVNSRHSACIMSV-VAWYXSNFSA-N.
| Molecular formula | C11H8N2O3S |
|---|---|
| Molecular weight | 248.26 g/mol |
| IUPAC name | (NE)-N-[(4-nitrophenyl)-thiophen-2-ylmethylidene]hydroxylamine |
| InChIKey | QLVNSRHSACIMSV-VAWYXSNFSA-N |
| SMILES | C1=CSC(=C1)/C(=N/O)/C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)