Products 1502813-63-9
CAS 1502813-63-9 is the registry number for PI3K-IN-7. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-[(E)-3-thiophen-2-ylprop-2-enylidene]-1,3-diazinane-2,4,6-trione (CAS 1502813-63-9) is a chemical compound with the molecular formula C11H8N2O3S and a molecular weight of 248.26 g/mol. IUPAC name: 5-[(E)-3-thiophen-2-ylprop-2-enylidene]-1,3-diazinane-2,4,6-trione. InChIKey: XVDGTYMDHFXORY-HNQUOIGGSA-N.
| Molecular formula | C11H8N2O3S |
|---|---|
| Molecular weight | 248.26 g/mol |
| IUPAC name | 5-[(E)-3-thiophen-2-ylprop-2-enylidene]-1,3-diazinane-2,4,6-trione |
| InChIKey | XVDGTYMDHFXORY-HNQUOIGGSA-N |
| SMILES | C1=CSC(=C1)/C=C/C=C2C(=O)NC(=O)NC2=O |
Computed by PubChem (NCBI)