CAS 39880-88-1 is the registry number for N-(4-Nitrophenyl)-2-thienylformamide. Offered by: Biosynth. Available pack sizes: 10g, 25g.
N-(4-nitrophenyl)thiophene-2-carboxamide (CAS 39880-88-1) is a chemical compound with the molecular formula C11H8N2O3S and a molecular weight of 248.26 g/mol. IUPAC name: N-(4-nitrophenyl)thiophene-2-carboxamide. InChIKey: FUSWAPGVSPAXMY-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O3S |
|---|---|
| Molecular weight | 248.26 g/mol |
| IUPAC name | N-(4-nitrophenyl)thiophene-2-carboxamide |
| InChIKey | FUSWAPGVSPAXMY-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C(=O)NC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)