CAS 117342-20-8 appears in our catalog under these names: 3–Methoxycarbonyl–5–nitrobenzeneboronic acid, 3-(Methoxycarbonyl)-5-nitrophenylboronic Acid (contains varying amounts of Anhydride), (3-(Methoxycarbonyl)-5-nitrophenyl)boronic acid, 98%, 98%, 3-Methoxycarbonyl-5-nitrophenylboronic acid, 98%, (3-(Methoxycarbonyl)-5-nitrophenyl)boronic acid, 98%. Offered by: GLPBio, TCI, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 10g, 25g, 100g.
(3-methoxycarbonyl-5-nitrophenyl)boronic acid (CAS 117342-20-8) is a chemical compound with the molecular formula C8H8BNO6 and a molecular weight of 224.97 g/mol. IUPAC name: (3-methoxycarbonyl-5-nitrophenyl)boronic acid. InChIKey: CDGIRLKQNJXHBJ-UHFFFAOYSA-N.
| Molecular formula | C8H8BNO6 |
|---|---|
| Molecular weight | 224.97 g/mol |
| IUPAC name | (3-methoxycarbonyl-5-nitrophenyl)boronic acid |
| InChIKey | CDGIRLKQNJXHBJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)[N+](=O)[O-])C(=O)OC)(O)O |
Computed by PubChem (NCBI)