Products 2211934-69-7
CAS 2211934-69-7 appears in our catalog under these names: (2-(Methoxycarbonyl)-5-nitrophenyl)boronic acid, 95%, 95%, (2-(Methoxycarbonyl)-5-nitrophenyl)boronic acid, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
(2-methoxycarbonyl-5-nitrophenyl)boronic acid (CAS 2211934-69-7) is a chemical compound with the molecular formula C8H8BNO6 and a molecular weight of 224.97 g/mol. IUPAC name: (2-methoxycarbonyl-5-nitrophenyl)boronic acid. InChIKey: DVMNFFMCYDSICW-UHFFFAOYSA-N.
| Molecular formula | C8H8BNO6 |
|---|---|
| Molecular weight | 224.97 g/mol |
| IUPAC name | (2-methoxycarbonyl-5-nitrophenyl)boronic acid |
| InChIKey | DVMNFFMCYDSICW-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)[N+](=O)[O-])C(=O)OC)(O)O |
Computed by PubChem (NCBI)