CAS 85107-56-8 appears in our catalog under these names: 4-Methoxycarbonyl-3-nitrophenylboronic acid, 98%, 98%, 4-Methoxycarbonyl-3-nitrophenylboronic acid, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 25g.
(4-methoxycarbonyl-3-nitrophenyl)boronic acid (CAS 85107-56-8) is a chemical compound with the molecular formula C8H8BNO6 and a molecular weight of 224.97 g/mol. IUPAC name: (4-methoxycarbonyl-3-nitrophenyl)boronic acid. InChIKey: NLNDQDNATQPFEC-UHFFFAOYSA-N.
| Molecular formula | C8H8BNO6 |
|---|---|
| Molecular weight | 224.97 g/mol |
| IUPAC name | (4-methoxycarbonyl-3-nitrophenyl)boronic acid |
| InChIKey | NLNDQDNATQPFEC-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C(=O)OC)[N+](=O)[O-])(O)O |
Computed by PubChem (NCBI)