Products 1173655-69-0
CAS 1173655-69-0 appears in our catalog under these names: Rabeprazole Impurity 44, Rabeprazole Impurity 12. Offered by: Chemat Brand. Available pack sizes: on request.
[4-(3-methoxypropoxy)-3-methyl-1-oxidopyridin-1-ium-2-yl]methanol (CAS 1173655-69-0) is a chemical compound with the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. IUPAC name: [4-(3-methoxypropoxy)-3-methyl-1-oxidopyridin-1-ium-2-yl]methanol. InChIKey: RTTOOAKNCBJONY-UHFFFAOYSA-N.
| Molecular formula | C11H17NO4 |
|---|---|
| Molecular weight | 227.26 g/mol |
| IUPAC name | [4-(3-methoxypropoxy)-3-methyl-1-oxidopyridin-1-ium-2-yl]methanol |
| InChIKey | RTTOOAKNCBJONY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C[N+](=C1CO)[O-])OCCCOC |
Computed by PubChem (NCBI)