CAS 117374-33-1 appears in our catalog under these names: Allylperfluorononanoate, 95%, Allyl perfluoro–n–nonanoate, Allyl perfluoro-n-nonanoate, 97%. Offered by: Chemat Brand, GLPBio, Fluorochem. Available pack sizes: on request, 10g, 1g, 25g, 5g.
Prop-2-enyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononanoate (CAS 117374-33-1) is a chemical compound with the molecular formula C12H5F17O2 and a molecular weight of 504.14 g/mol. IUPAC name: prop-2-enyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononanoate. InChIKey: DCARDCAPXKDJAG-UHFFFAOYSA-N.
| Molecular formula | C12H5F17O2 |
|---|---|
| Molecular weight | 504.14 g/mol |
| IUPAC name | prop-2-enyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononanoate |
| InChIKey | DCARDCAPXKDJAG-UHFFFAOYSA-N |
| SMILES | C=CCOC(=O)C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)