CAS 203201-14-3 is the registry number for (Perfluorononanoyl)acetone, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heptadecafluorododecane-2,4-dione (CAS 203201-14-3) is a chemical compound with the molecular formula C12H5F17O2 and a molecular weight of 504.14 g/mol. IUPAC name: 5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heptadecafluorododecane-2,4-dione. InChIKey: LOPUACNVJXKLKA-UHFFFAOYSA-N.
| Molecular formula | C12H5F17O2 |
|---|---|
| Molecular weight | 504.14 g/mol |
| IUPAC name | 5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heptadecafluorododecane-2,4-dione |
| InChIKey | LOPUACNVJXKLKA-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(=O)C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)