CAS 307-87-9 is the registry number for 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-Heptadecafluorononyl prop-2-enoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononyl prop-2-enoate (CAS 307-87-9) is a chemical compound with the molecular formula C12H5F17O2 and a molecular weight of 504.14 g/mol. IUPAC name: 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononyl prop-2-enoate. InChIKey: BZYSOYLWVDQYMZ-UHFFFAOYSA-N.
| Molecular formula | C12H5F17O2 |
|---|---|
| Molecular weight | 504.14 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononyl prop-2-enoate |
| InChIKey | BZYSOYLWVDQYMZ-UHFFFAOYSA-N |
| SMILES | C=CC(=O)OCC(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)