CAS 117391-50-1 appears in our catalog under these names: DL–3–Amino–3–(3–Bromophenyl)propionic acid, 3-Amino-3-(3-bromophenyl)propionic acid, 3-Amino-3-(3-bromophenyl)propionic Acid, >98.0%(HPLC)(T), H-DL-β-(3-Br-Phenyl)-Ala-OH 97%, 3-Amino-3-(3-bromophenyl)propanoic acid, 97%, 97%. Offered by: GLPBio, Biosynth, TCI, Ambeed, Chemat. Available pack sizes: 10g, 2,5g, 1g, 5g, 0,25g, 250mg, 25g, 100g.
3-amino-3-(3-bromophenyl)propanoic acid (CAS 117391-50-1) is a chemical compound with the molecular formula C9H10BrNO2 and a molecular weight of 244.08 g/mol. IUPAC name: 3-amino-3-(3-bromophenyl)propanoic acid. InChIKey: RLYAXKJHJUXZOT-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNO2 |
|---|---|
| Molecular weight | 244.08 g/mol |
| IUPAC name | 3-amino-3-(3-bromophenyl)propanoic acid |
| InChIKey | RLYAXKJHJUXZOT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C(CC(=O)O)N |
Computed by PubChem (NCBI)