Products 1174-11-4
CAS 1174-11-4 appears in our catalog under these names: Xenazoic Acid, Xenalamine (Xenazoic acid), Xenalamine. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 25mg, 50mg, 5mg, 1mg, 10mg, 25 mg, 5 mg, 50 mg.
4-[[1-ethoxy-2-oxo-2-(4-phenylphenyl)ethyl]amino]benzoic acid (CAS 1174-11-4) is a chemical compound with the molecular formula C23H21NO4 and a molecular weight of 375.4 g/mol. IUPAC name: 4-[[1-ethoxy-2-oxo-2-(4-phenylphenyl)ethyl]amino]benzoic acid. InChIKey: BPOMPTVRBWXZBY-UHFFFAOYSA-N.
| Molecular formula | C23H21NO4 |
|---|---|
| Molecular weight | 375.4 g/mol |
| IUPAC name | 4-[[1-ethoxy-2-oxo-2-(4-phenylphenyl)ethyl]amino]benzoic acid |
| InChIKey | BPOMPTVRBWXZBY-UHFFFAOYSA-N |
| SMILES | CCOC(C(=O)C1=CC=C(C=C1)C2=CC=CC=C2)NC3=CC=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)