Products 2155856-17-8

CAS 2155856-17-8 is the registry number for 3-((2-Methylphenyl)formamido)-3-(3-phenoxyphenyl)propanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

3-[(2-methylbenzoyl)amino]-3-(3-phenoxyphenyl)propanoic acid (CAS 2155856-17-8) is a chemical compound with the molecular formula C23H21NO4 and a molecular weight of 375.4 g/mol. IUPAC name: 3-[(2-methylbenzoyl)amino]-3-(3-phenoxyphenyl)propanoic acid. InChIKey: HPRZEXXDMFIKAU-UHFFFAOYSA-N.

Identity
Molecular formulaC23H21NO4
Molecular weight375.4 g/mol
IUPAC name3-[(2-methylbenzoyl)amino]-3-(3-phenoxyphenyl)propanoic acid
InChIKeyHPRZEXXDMFIKAU-UHFFFAOYSA-N
SMILESCC1=CC=CC=C1C(=O)NC(CC(=O)O)C2=CC(=CC=C2)OC3=CC=CC=C3

Computed by PubChem (NCBI)