CAS 176794-80-2 is the registry number for Cbz-4-Biphenyl-D-alanine, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 250mg.
(2R)-2-(phenylmethoxycarbonylamino)-3-(4-phenylphenyl)propanoic acid (CAS 176794-80-2) is a chemical compound with the molecular formula C23H21NO4 and a molecular weight of 375.4 g/mol. IUPAC name: (2R)-2-(phenylmethoxycarbonylamino)-3-(4-phenylphenyl)propanoic acid. InChIKey: ZZIBVIHXEMIHEQ-OAQYLSRUSA-N.
| Molecular formula | C23H21NO4 |
|---|---|
| Molecular weight | 375.4 g/mol |
| IUPAC name | (2R)-2-(phenylmethoxycarbonylamino)-3-(4-phenylphenyl)propanoic acid |
| InChIKey | ZZIBVIHXEMIHEQ-OAQYLSRUSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@H](CC2=CC=C(C=C2)C3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)