Products 1174044-69-9

CAS 1174044-69-9 is the registry number for 3-((8-Chloro-4-oxo-3,4-dihydrophthalazin-1-yl)methyl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-[(8-chloro-4-oxo-3H-phthalazin-1-yl)methyl]benzoic acid (CAS 1174044-69-9) is a chemical compound with the molecular formula C16H11ClN2O3 and a molecular weight of 314.72 g/mol. IUPAC name: 3-[(8-chloro-4-oxo-3H-phthalazin-1-yl)methyl]benzoic acid. InChIKey: QJIVPMJBJJBNPS-UHFFFAOYSA-N.

Identity
Molecular formulaC16H11ClN2O3
Molecular weight314.72 g/mol
IUPAC name3-[(8-chloro-4-oxo-3H-phthalazin-1-yl)methyl]benzoic acid
InChIKeyQJIVPMJBJJBNPS-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)C(=O)O)CC2=NNC(=O)C3=C2C(=CC=C3)Cl

Computed by PubChem (NCBI)