CAS 852932-31-1 is the registry number for 4-Chloro-1-(2-methyl(8-quinolyloxy))-2-nitrobenzene. Offered by: Biosynth. Available pack sizes: 2g, 1g.
8-(4-chloro-2-nitrophenoxy)-2-methylquinoline (CAS 852932-31-1) is a chemical compound with the molecular formula C16H11ClN2O3 and a molecular weight of 314.72 g/mol. IUPAC name: 8-(4-chloro-2-nitrophenoxy)-2-methylquinoline. InChIKey: YSAQNDQXMRTKGM-UHFFFAOYSA-N.
| Molecular formula | C16H11ClN2O3 |
|---|---|
| Molecular weight | 314.72 g/mol |
| IUPAC name | 8-(4-chloro-2-nitrophenoxy)-2-methylquinoline |
| InChIKey | YSAQNDQXMRTKGM-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=CC=C2OC3=C(C=C(C=C3)Cl)[N+](=O)[O-])C=C1 |
Computed by PubChem (NCBI)