Products 617694-49-2
CAS 617694-49-2 is the registry number for N-(2-chlorophenyl)-2-(2,3-dioxo-2,3-dihydro-1H-indol-1-yl)acetamide, ≥98%, ≥98%. Offered by: Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 250mg.
N-(2-chlorophenyl)-2-(2,3-dioxoindol-1-yl)acetamide (CAS 617694-49-2) is a chemical compound with the molecular formula C16H11ClN2O3 and a molecular weight of 314.72 g/mol. IUPAC name: N-(2-chlorophenyl)-2-(2,3-dioxoindol-1-yl)acetamide. InChIKey: NYGUSLZRQFNIJT-UHFFFAOYSA-N.
| Molecular formula | C16H11ClN2O3 |
|---|---|
| Molecular weight | 314.72 g/mol |
| IUPAC name | N-(2-chlorophenyl)-2-(2,3-dioxoindol-1-yl)acetamide |
| InChIKey | NYGUSLZRQFNIJT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C(=O)N2CC(=O)NC3=CC=CC=C3Cl |
Computed by PubChem (NCBI)