Products 117406-91-4
CAS 117406-91-4 appears in our catalog under these names: Methyl (2R,3S)-2,3-dihydroxybutanoate, 98%, Methyl (2R,3S)-2,3-dihydroxybutanoate, 95%, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg.
Methyl (2R,3S)-2,3-dihydroxybutanoate (CAS 117406-91-4) is a chemical compound with the molecular formula C5H10O4 and a molecular weight of 134.13 g/mol. IUPAC name: methyl (2R,3S)-2,3-dihydroxybutanoate. InChIKey: WSWXGWWRXBEESI-IUYQGCFVSA-N.
| Molecular formula | C5H10O4 |
|---|---|
| Molecular weight | 134.13 g/mol |
| IUPAC name | methyl (2R,3S)-2,3-dihydroxybutanoate |
| InChIKey | WSWXGWWRXBEESI-IUYQGCFVSA-N |
| SMILES | C[C@@H]([C@H](C(=O)OC)O)O |
Computed by PubChem (NCBI)