CAS 38410-83-2 is the registry number for Methyl (2S,3R)-2,3-dihydroxybutanoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (2S,3R)-2,3-dihydroxybutanoate (CAS 38410-83-2) is a chemical compound with the molecular formula C5H10O4 and a molecular weight of 134.13 g/mol. IUPAC name: methyl (2S,3R)-2,3-dihydroxybutanoate. InChIKey: WSWXGWWRXBEESI-DMTCNVIQSA-N.
| Molecular formula | C5H10O4 |
|---|---|
| Molecular weight | 134.13 g/mol |
| IUPAC name | methyl (2S,3R)-2,3-dihydroxybutanoate |
| InChIKey | WSWXGWWRXBEESI-DMTCNVIQSA-N |
| SMILES | C[C@H]([C@@H](C(=O)OC)O)O |
Computed by PubChem (NCBI)