CAS 1174848-25-9 appears in our catalog under these names: 1-(1-Ethyl-1H-pyrazol-4-yl)-2,2,2-trifluoroethan-1-one, 95%, 1-(1-Ethyl-1H-pyrazol-4-yl)-2,2,2-trifluoroethan-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
1-(1-ethylpyrazol-4-yl)-2,2,2-trifluoroethanone (CAS 1174848-25-9) is a chemical compound with the molecular formula C7H7F3N2O and a molecular weight of 192.14 g/mol. IUPAC name: 1-(1-ethylpyrazol-4-yl)-2,2,2-trifluoroethanone. InChIKey: GHCNDJSHSRZDCT-UHFFFAOYSA-N.
| Molecular formula | C7H7F3N2O |
|---|---|
| Molecular weight | 192.14 g/mol |
| IUPAC name | 1-(1-ethylpyrazol-4-yl)-2,2,2-trifluoroethanone |
| InChIKey | GHCNDJSHSRZDCT-UHFFFAOYSA-N |
| SMILES | CCN1C=C(C=N1)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)