CAS 1174849-23-0 is the registry number for ((3-(1-Methyl-1H-pyrazol-4-yl)isoxazol-5-yl)methyl)amine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
[3-(1-methylpyrazol-4-yl)-1,2-oxazol-5-yl]methanamine (CAS 1174849-23-0) is a chemical compound with the molecular formula C8H10N4O and a molecular weight of 178.19 g/mol. IUPAC name: [3-(1-methylpyrazol-4-yl)-1,2-oxazol-5-yl]methanamine. InChIKey: FRUCQESCGLXUNR-UHFFFAOYSA-N.
| Molecular formula | C8H10N4O |
|---|---|
| Molecular weight | 178.19 g/mol |
| IUPAC name | [3-(1-methylpyrazol-4-yl)-1,2-oxazol-5-yl]methanamine |
| InChIKey | FRUCQESCGLXUNR-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=N1)C2=NOC(=C2)CN |
Computed by PubChem (NCBI)