Products 1174858-83-3
CAS 1174858-83-3 is the registry number for 1-(4-Chlorophenyl)-3-(4-methoxyphenyl)-1h-pyrazol-5-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(4-chlorophenyl)-5-(4-methoxyphenyl)-1H-pyrazol-3-one (CAS 1174858-83-3) is a chemical compound with the molecular formula C16H13ClN2O2 and a molecular weight of 300.74 g/mol. IUPAC name: 2-(4-chlorophenyl)-5-(4-methoxyphenyl)-1H-pyrazol-3-one. InChIKey: BFUVRJHLLDCBKQ-UHFFFAOYSA-N.
| Molecular formula | C16H13ClN2O2 |
|---|---|
| Molecular weight | 300.74 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-5-(4-methoxyphenyl)-1H-pyrazol-3-one |
| InChIKey | BFUVRJHLLDCBKQ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CC(=O)N(N2)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)