CAS 17311-35-2 appears in our catalog under these names: Temazepam Impurity 8, p-Hydroxy Diazepam, >95% (HPLC), p-Hydroxy Diazepam (1.0mg/ml in Acetonitrile). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 50mg, 5mg, 5x1ml.
7-chloro-5-(4-hydroxyphenyl)-1-methyl-3H-1,4-benzodiazepin-2-one (CAS 17311-35-2) is a chemical compound with the molecular formula C16H13ClN2O2 and a molecular weight of 300.74 g/mol. IUPAC name: 7-chloro-5-(4-hydroxyphenyl)-1-methyl-3H-1,4-benzodiazepin-2-one. InChIKey: IQFWLIWUKIFGKP-UHFFFAOYSA-N.
| Molecular formula | C16H13ClN2O2 |
|---|---|
| Molecular weight | 300.74 g/mol |
| IUPAC name | 7-chloro-5-(4-hydroxyphenyl)-1-methyl-3H-1,4-benzodiazepin-2-one |
| InChIKey | IQFWLIWUKIFGKP-UHFFFAOYSA-N |
| SMILES | CN1C(=O)CN=C(C2=C1C=CC(=C2)Cl)C3=CC=C(C=C3)O |
Computed by PubChem (NCBI)