CAS 937650-48-1 is the registry number for 3-[4-(Benzyloxy)phenyl]-5-(chloromethyl)-1,2,4-oxadiazole, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
5-(chloromethyl)-3-(4-phenylmethoxyphenyl)-1,2,4-oxadiazole (CAS 937650-48-1) is a chemical compound with the molecular formula C16H13ClN2O2 and a molecular weight of 300.74 g/mol. IUPAC name: 5-(chloromethyl)-3-(4-phenylmethoxyphenyl)-1,2,4-oxadiazole. InChIKey: SKQJNKCXEAWCGM-UHFFFAOYSA-N.
| Molecular formula | C16H13ClN2O2 |
|---|---|
| Molecular weight | 300.74 g/mol |
| IUPAC name | 5-(chloromethyl)-3-(4-phenylmethoxyphenyl)-1,2,4-oxadiazole |
| InChIKey | SKQJNKCXEAWCGM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)C3=NOC(=N3)CCl |
Computed by PubChem (NCBI)