Products 1174878-96-6
CAS 1174878-96-6 appears in our catalog under these names: 5-Carbamoyl-1-methyl-1H-pyrazole-3-carboxylic acid, 5-Carbamoyl-1-methyl-1H-pyrazole-3-carboxylic acid, 95%, 5-(aminocarbonyl)-1-methyl-1H-pyrazole-3-carboxylic acid, 95%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 1g.
5-carbamoyl-1-methylpyrazole-3-carboxylic acid (CAS 1174878-96-6) is a chemical compound with the molecular formula C6H7N3O3 and a molecular weight of 169.14 g/mol. IUPAC name: 5-carbamoyl-1-methylpyrazole-3-carboxylic acid. InChIKey: LCEHKAOXBXVXDL-UHFFFAOYSA-N.
| Molecular formula | C6H7N3O3 |
|---|---|
| Molecular weight | 169.14 g/mol |
| IUPAC name | 5-carbamoyl-1-methylpyrazole-3-carboxylic acid |
| InChIKey | LCEHKAOXBXVXDL-UHFFFAOYSA-N |
| SMILES | CN1C(=CC(=N1)C(=O)O)C(=O)N |
Computed by PubChem (NCBI)