Products 1175002-07-9
CAS 1175002-07-9 is the registry number for 4-(Dimethylamino)benzoic-2,3,5,6-d4 Acid. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 50mg, 5mg, 5 mg, 50 mg, 10 mg.
2,3,5,6-tetradeuterio-4-(dimethylamino)benzoic acid (CAS 1175002-07-9) is a chemical compound with the molecular formula C9H11NO2 and a molecular weight of 169.21 g/mol. IUPAC name: 2,3,5,6-tetradeuterio-4-(dimethylamino)benzoic acid. InChIKey: YDIYEOMDOWUDTJ-LNFUJOGGSA-N.
| Molecular formula | C9H11NO2 |
|---|---|
| Molecular weight | 169.21 g/mol |
| IUPAC name | 2,3,5,6-tetradeuterio-4-(dimethylamino)benzoic acid |
| InChIKey | YDIYEOMDOWUDTJ-LNFUJOGGSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C(=O)O)[2H])[2H])N(C)C)[2H] |
Computed by PubChem (NCBI)