Products 1175002-09-1
CAS 1175002-09-1 is the registry number for 4-Dimethylamino Benzoic Acid-d6. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, 5mg, 1mg.
4-[bis(trideuteriomethyl)amino]benzoic acid (CAS 1175002-09-1) is a chemical compound with the molecular formula C9H11NO2 and a molecular weight of 171.23 g/mol. IUPAC name: 4-[bis(trideuteriomethyl)amino]benzoic acid. InChIKey: YDIYEOMDOWUDTJ-WFGJKAKNSA-N.
| Molecular formula | C9H11NO2 |
|---|---|
| Molecular weight | 171.23 g/mol |
| IUPAC name | 4-[bis(trideuteriomethyl)amino]benzoic acid |
| InChIKey | YDIYEOMDOWUDTJ-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])N(C1=CC=C(C=C1)C(=O)O)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)