CAS 117517-20-1 appears in our catalog under these names: 3'-Deoxy-3'-fluoroinosine, 3’-Deoxy-3’-fluoroinosine. Offered by: Biosynth, MedChemExpress. Available pack sizes: 10g, 5g, Get quote.
9-[(2R,3S,4S,5R)-4-fluoro-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one (CAS 117517-20-1) is a chemical compound with the molecular formula C10H11FN4O4 and a molecular weight of 270.22 g/mol. IUPAC name: 9-[(2R,3S,4S,5R)-4-fluoro-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one. InChIKey: POYFYFKHABGRAR-QYYRPYCUSA-N.
| Molecular formula | C10H11FN4O4 |
|---|---|
| Molecular weight | 270.22 g/mol |
| IUPAC name | 9-[(2R,3S,4S,5R)-4-fluoro-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
| InChIKey | POYFYFKHABGRAR-QYYRPYCUSA-N |
| SMILES | C1=NC2=C(C(=O)N1)N=CN2[C@H]3[C@@H]([C@@H]([C@H](O3)CO)F)O |
Computed by PubChem (NCBI)