CAS 80049-87-2 appears in our catalog under these names: 2'-Deoxy-2'-fluoroinosine, 2 g, 2'–Deoxy–2'–fluoroinosine, 2'-Deoxy-2'-fluoroinosine, 2'-Deoxy-2'-fluoroinosine, 95%, 2'-Fluoro-2'-deoxyinosine, 99% . Offered by: Roth, GLPBio, Biosynth, Combi-blocks, Thermo Scientific (Alfa Aesar). Available pack sizes: 2g, 1g, 250mg, 1000mg, 500mg, 2000mg, 10000mg, 5000mg.
9-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one (CAS 80049-87-2) is a chemical compound with the molecular formula C10H11FN4O4 and a molecular weight of 270.22 g/mol. IUPAC name: 9-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one. InChIKey: NRVOTDBYJXFINS-QYYRPYCUSA-N.
| Molecular formula | C10H11FN4O4 |
|---|---|
| Molecular weight | 270.22 g/mol |
| IUPAC name | 9-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
| InChIKey | NRVOTDBYJXFINS-QYYRPYCUSA-N |
| SMILES | C1=NC2=C(C(=O)N1)N=CN2[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)F |
Computed by PubChem (NCBI)