CAS 171667-46-2 is the registry number for 3’-Deoxy-3’-fluoro-beta-D-xylo-inosine. Offered by: MedChemExpress. Available pack sizes: Get quote.
9-[(2R,3S,4R,5R)-4-fluoro-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one (CAS 171667-46-2) is a chemical compound with the molecular formula C10H11FN4O4 and a molecular weight of 270.22 g/mol. IUPAC name: 9-[(2R,3S,4R,5R)-4-fluoro-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one. InChIKey: POYFYFKHABGRAR-GQTRHBFLSA-N.
| Molecular formula | C10H11FN4O4 |
|---|---|
| Molecular weight | 270.22 g/mol |
| IUPAC name | 9-[(2R,3S,4R,5R)-4-fluoro-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
| InChIKey | POYFYFKHABGRAR-GQTRHBFLSA-N |
| SMILES | C1=NC2=C(C(=O)N1)N=CN2[C@H]3[C@@H]([C@H]([C@H](O3)CO)F)O |
Computed by PubChem (NCBI)