Products 117520-24-8
CAS 117520-24-8 appears in our catalog under these names: 1–(4–bromo–3–methylphenyl)ethanamine hydrochloride, 1-(4-Bromo-3-methylphenyl)ethan-1-amine hcl, 97%, 97%, 1-(4-BROMO-3-METHYLPHENYL)ETHAN-1-AMINE HCL, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g, 25g.
1-(4-bromo-3-methylphenyl)ethanamine;hydrochloride (CAS 117520-24-8) is a chemical compound with the molecular formula C9H13BrClN and a molecular weight of 250.56 g/mol. IUPAC name: 1-(4-bromo-3-methylphenyl)ethanamine;hydrochloride. InChIKey: SCQFKYGGAVQXAW-UHFFFAOYSA-N.
| Molecular formula | C9H13BrClN |
|---|---|
| Molecular weight | 250.56 g/mol |
| IUPAC name | 1-(4-bromo-3-methylphenyl)ethanamine;hydrochloride |
| InChIKey | SCQFKYGGAVQXAW-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(C)N)Br.Cl |
Computed by PubChem (NCBI)