Products 2193052-11-6
CAS 2193052-11-6 appears in our catalog under these names: (1S)-1-(4-Bromo-3-methylphenyl)ethan-1-amine hydrochloride, (s)-1-(4-Bromo-3-methylphenyl)ethan-1-amine hydrochloride, 98%, 98%, (S)-1-(4-BROMO-3-METHYLPHENYL)ETHAN-1-AMINE HCL, 98%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g.
(1S)-1-(4-bromo-3-methylphenyl)ethanamine;hydrochloride (CAS 2193052-11-6) is a chemical compound with the molecular formula C9H13BrClN and a molecular weight of 250.56 g/mol. IUPAC name: (1S)-1-(4-bromo-3-methylphenyl)ethanamine;hydrochloride. InChIKey: SCQFKYGGAVQXAW-FJXQXJEOSA-N.
| Molecular formula | C9H13BrClN |
|---|---|
| Molecular weight | 250.56 g/mol |
| IUPAC name | (1S)-1-(4-bromo-3-methylphenyl)ethanamine;hydrochloride |
| InChIKey | SCQFKYGGAVQXAW-FJXQXJEOSA-N |
| SMILES | CC1=C(C=CC(=C1)[C@H](C)N)Br.Cl |
Computed by PubChem (NCBI)