Products 1175653-21-0
CAS 1175653-21-0 is the registry number for 2'-(Dimethylamino)biphenyl-3-carboxylic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
3-[2-(dimethylamino)phenyl]benzoic acid (CAS 1175653-21-0) is a chemical compound with the molecular formula C15H15NO2 and a molecular weight of 241.28 g/mol. IUPAC name: 3-[2-(dimethylamino)phenyl]benzoic acid. InChIKey: NFUXGIOHGLAWBS-UHFFFAOYSA-N.
| Molecular formula | C15H15NO2 |
|---|---|
| Molecular weight | 241.28 g/mol |
| IUPAC name | 3-[2-(dimethylamino)phenyl]benzoic acid |
| InChIKey | NFUXGIOHGLAWBS-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=CC=C1C2=CC(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)