Products 1175880-15-5
CAS 1175880-15-5 appears in our catalog under these names: Ugandenial A, Ugandenial A. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, 5 mg, 1 mg.
(1R,5aS,9aS,9bS)-1,9b-dihydroxy-6,6,9a-trimethyl-1,5,5a,7,8,9-hexahydrobenzo[e][2]benzofuran-3-one (CAS 1175880-15-5) is a chemical compound with the molecular formula C15H22O4 and a molecular weight of 266.33 g/mol. IUPAC name: (1R,5aS,9aS,9bS)-1,9b-dihydroxy-6,6,9a-trimethyl-1,5,5a,7,8,9-hexahydrobenzo[e][2]benzofuran-3-one. InChIKey: XLGNZQXMDVSKOV-FDEJFUCISA-N.
| Molecular formula | C15H22O4 |
|---|---|
| Molecular weight | 266.33 g/mol |
| IUPAC name | (1R,5aS,9aS,9bS)-1,9b-dihydroxy-6,6,9a-trimethyl-1,5,5a,7,8,9-hexahydrobenzo[e][2]benzofuran-3-one |
| InChIKey | XLGNZQXMDVSKOV-FDEJFUCISA-N |
| SMILES | C[C@]12CCCC([C@@H]1CC=C3[C@@]2([C@@H](OC3=O)O)O)(C)C |
Computed by PubChem (NCBI)
Synonyms:
Ugandenial A, orb1681345