Products 1175906-30-5
CAS 1175906-30-5 is the registry number for 4-(3-Bromopropyl)-N,N-dimethylbenzenesulfonamide, 95%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 100mg, 250mg, 1g.
4-(3-bromopropyl)-N,N-dimethylbenzenesulfonamide (CAS 1175906-30-5) is a chemical compound with the molecular formula C11H16BrNO2S and a molecular weight of 306.22 g/mol. IUPAC name: 4-(3-bromopropyl)-N,N-dimethylbenzenesulfonamide. InChIKey: LHRRSBXXXDFWFJ-UHFFFAOYSA-N.
| Molecular formula | C11H16BrNO2S |
|---|---|
| Molecular weight | 306.22 g/mol |
| IUPAC name | 4-(3-bromopropyl)-N,N-dimethylbenzenesulfonamide |
| InChIKey | LHRRSBXXXDFWFJ-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=CC=C(C=C1)CCCBr |
Computed by PubChem (NCBI)