Products 117591-81-8
CAS 117591-81-8 appears in our catalog under these names: Coronarin E, Coronarin E, ≥98%, ≥98%, Coronarin E, 98%. Offered by: Chemat Brand, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: on request, 5mg, 50mg, 25mg, 1 mg.
3-[(E)-2-[(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethenyl]furan (CAS 117591-81-8) is a chemical compound with the molecular formula C20H28O and a molecular weight of 284.4 g/mol. IUPAC name: 3-[(E)-2-[(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethenyl]furan. InChIKey: QXVXYNOIXUIXBI-NDLVVHCESA-N.
| Molecular formula | C20H28O |
|---|---|
| Molecular weight | 284.4 g/mol |
| IUPAC name | 3-[(E)-2-[(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethenyl]furan |
| InChIKey | QXVXYNOIXUIXBI-NDLVVHCESA-N |
| SMILES | C[C@]12CCCC([C@@H]1CCC(=C)[C@@H]2/C=C/C3=COC=C3)(C)C |
Computed by PubChem (NCBI)