CAS 90694-28-3 is the registry number for 13-cis-3-Dehydroretinol. Offered by: TRC. Available pack sizes: 10mg.
(2Z,4Z,6E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)nona-2,4,6,8-tetraen-1-ol (CAS 90694-28-3) is a chemical compound with the molecular formula C20H28O and a molecular weight of 284.4 g/mol. IUPAC name: (2Z,4Z,6E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)nona-2,4,6,8-tetraen-1-ol. InChIKey: XWCYDHJOKKGVHC-PQCRVBQNSA-N.
| Molecular formula | C20H28O |
|---|---|
| Molecular weight | 284.4 g/mol |
| IUPAC name | (2Z,4Z,6E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)nona-2,4,6,8-tetraen-1-ol |
| InChIKey | XWCYDHJOKKGVHC-PQCRVBQNSA-N |
| SMILES | CC1=C(C(CC=C1)(C)C)C=C/C(=C/C=C\C(=C/CO)\C)/C |
Computed by PubChem (NCBI)