Products 29443-88-7
CAS 29443-88-7 is the registry number for 11,12-Didehydro Retinol. Offered by: TRC. Available pack sizes: 10mg, 1mg.
(2E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,6,8-trien-4-yn-1-ol (CAS 29443-88-7) is a chemical compound with the molecular formula C20H28O and a molecular weight of 284.4 g/mol. IUPAC name: (2E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,6,8-trien-4-yn-1-ol. InChIKey: GCOWPJRSSDVABG-YSVSHSNWSA-N.
| Molecular formula | C20H28O |
|---|---|
| Molecular weight | 284.4 g/mol |
| IUPAC name | (2E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,6,8-trien-4-yn-1-ol |
| InChIKey | GCOWPJRSSDVABG-YSVSHSNWSA-N |
| SMILES | CC1=C(C(CCC1)(C)C)/C=C/C(=C/C#C/C(=C/CO)/C)/C |
Computed by PubChem (NCBI)
Synonyms:
11,12-Didehydro Retinol, 11,12-Didehydroretinol