CAS 1175961-05-3 is the registry number for (3,5-Dimethyl-1-(3-(trifluoromethyl)phenyl)-1h-pyrazol-4-yl)methanol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.
[3,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]methanol (CAS 1175961-05-3) is a chemical compound with the molecular formula C13H13F3N2O and a molecular weight of 270.25 g/mol. IUPAC name: [3,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]methanol. InChIKey: KKPSYBPEDBUXSZ-UHFFFAOYSA-N.
| Molecular formula | C13H13F3N2O |
|---|---|
| Molecular weight | 270.25 g/mol |
| IUPAC name | [3,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]methanol |
| InChIKey | KKPSYBPEDBUXSZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1C2=CC=CC(=C2)C(F)(F)F)C)CO |
Computed by PubChem (NCBI)