Products 1354951-96-4
CAS 1354951-96-4 is the registry number for 1-(3,5-Dimethyl-1-phenyl-1H-pyrazol-4-yl)-2,2,2-trifluoroethan-1-ol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2,2,2-trifluoroethanol (CAS 1354951-96-4) is a chemical compound with the molecular formula C13H13F3N2O and a molecular weight of 270.25 g/mol. IUPAC name: 1-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2,2,2-trifluoroethanol. InChIKey: LNWVNSTWSGJFPA-UHFFFAOYSA-N.
| Molecular formula | C13H13F3N2O |
|---|---|
| Molecular weight | 270.25 g/mol |
| IUPAC name | 1-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2,2,2-trifluoroethanol |
| InChIKey | LNWVNSTWSGJFPA-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1C2=CC=CC=C2)C)C(C(F)(F)F)O |
Computed by PubChem (NCBI)