Products 2752430-60-5
CAS 2752430-60-5 is the registry number for 5-(Trifluoromethyl)spiro[indoline-2,4'-piperidin]-3-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(trifluoromethyl)spiro[1H-indole-2,4'-piperidine]-3-one (CAS 2752430-60-5) is a chemical compound with the molecular formula C13H13F3N2O and a molecular weight of 270.25 g/mol. IUPAC name: 5-(trifluoromethyl)spiro[1H-indole-2,4'-piperidine]-3-one. InChIKey: CHWPITSITDIWAG-UHFFFAOYSA-N.
| Molecular formula | C13H13F3N2O |
|---|---|
| Molecular weight | 270.25 g/mol |
| IUPAC name | 5-(trifluoromethyl)spiro[1H-indole-2,4'-piperidine]-3-one |
| InChIKey | CHWPITSITDIWAG-UHFFFAOYSA-N |
| SMILES | C1CNCCC12C(=O)C3=C(N2)C=CC(=C3)C(F)(F)F |
Computed by PubChem (NCBI)