Products 1176042-72-0
CAS 1176042-72-0 is the registry number for 1-Methyl-4-(m-tolyl)piperidine-4-carboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-methyl-4-(3-methylphenyl)piperidine-4-carboxylic acid (CAS 1176042-72-0) is a chemical compound with the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. IUPAC name: 1-methyl-4-(3-methylphenyl)piperidine-4-carboxylic acid. InChIKey: GWXHHOSRLVCZLN-UHFFFAOYSA-N.
| Molecular formula | C14H19NO2 |
|---|---|
| Molecular weight | 233.31 g/mol |
| IUPAC name | 1-methyl-4-(3-methylphenyl)piperidine-4-carboxylic acid |
| InChIKey | GWXHHOSRLVCZLN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C2(CCN(CC2)C)C(=O)O |
Computed by PubChem (NCBI)