CAS 1176058-71-1 appears in our catalog under these names: 7-Fluoro-5-nitro-2,3-dihydro-1H-indole-2,3-dione, 95%, 7-Fluoro-5-nitro-2,3-dihydro-1H-indole-2,3-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
7-fluoro-5-nitro-1H-indole-2,3-dione (CAS 1176058-71-1) is a chemical compound with the molecular formula C8H3FN2O4 and a molecular weight of 210.12 g/mol. IUPAC name: 7-fluoro-5-nitro-1H-indole-2,3-dione. InChIKey: OFYFNDZJUKUTMG-UHFFFAOYSA-N.
| Molecular formula | C8H3FN2O4 |
|---|---|
| Molecular weight | 210.12 g/mol |
| IUPAC name | 7-fluoro-5-nitro-1H-indole-2,3-dione |
| InChIKey | OFYFNDZJUKUTMG-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1C(=O)C(=O)N2)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)