CAS 954571-39-2 appears in our catalog under these names: 5-Fluoro-7-nitro-1h-indole-2,3-dione, 95%, 5-Fluoro-7-nitroindoline-2,3-dione, 95%, 95%, 5-Fluoro-7-nitro-2,3-dihydro-1h-indole-2,3-dione, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
5-fluoro-7-nitro-1H-indole-2,3-dione (CAS 954571-39-2) is a chemical compound with the molecular formula C8H3FN2O4 and a molecular weight of 210.12 g/mol. IUPAC name: 5-fluoro-7-nitro-1H-indole-2,3-dione. InChIKey: WGBLCTOGPSHGGJ-UHFFFAOYSA-N.
| Molecular formula | C8H3FN2O4 |
|---|---|
| Molecular weight | 210.12 g/mol |
| IUPAC name | 5-fluoro-7-nitro-1H-indole-2,3-dione |
| InChIKey | WGBLCTOGPSHGGJ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1C(=O)C(=O)N2)[N+](=O)[O-])F |
Computed by PubChem (NCBI)