CAS 953751-33-2 is the registry number for 6-Fluoro-5-nitroindoline-2,3-dione, 98%. Offered by: AmBeed. Available pack sizes: 25g, 10g.
6-fluoro-5-nitro-1H-indole-2,3-dione (CAS 953751-33-2) is a chemical compound with the molecular formula C8H3FN2O4 and a molecular weight of 210.12 g/mol. IUPAC name: 6-fluoro-5-nitro-1H-indole-2,3-dione. InChIKey: PUULBMGUQRBTGM-UHFFFAOYSA-N.
| Molecular formula | C8H3FN2O4 |
|---|---|
| Molecular weight | 210.12 g/mol |
| IUPAC name | 6-fluoro-5-nitro-1H-indole-2,3-dione |
| InChIKey | PUULBMGUQRBTGM-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1[N+](=O)[O-])F)NC(=O)C2=O |
Computed by PubChem (NCBI)